|
Product Details:
|
| Product Name: | Bisphenol AF | CAS: | 1478-61-1 |
|---|---|---|---|
| EINECS: | 216-036-7 | Melting Point: | 160-163 °C(lit.) |
| Storage Temp.: | Inert Atmosphere,Room Temperature | Form: | Powder |
| Color: | White To Pale Beige | ||
| Highlight: | Bisphenol AF biochemical reagent,CAS 1478-61-1 lab chemical,Bisphenol AF industrial fine chemical |
||
| Product Name: | Bisphenol AF |
| Synonyms: | 4,4'-(HEXAFLUOROISOPROPYLIDENE)DIPHEOL;2,2-BIS(4-HYDROXYPHENYL)HEXAFLUOROPROPANE;TIMTEC-BB SBB001375;HexafluorophenolA;BISPHENOL AF-M;BPAF;2,2-BIS(PARA-HYDROXYPHENYL)PERFLUOROPROPANE;BPAF(Bisphenol AF) |
| CAS: | 1478-61-1 |
| MF: | C15H10F6O2 |
| MW: | 336.23 |
| EINECS: | 216-036-7 |
| Product Categories: | Bisphenol AF type Compounds (for High-Performance Polymer Research);Functional Materials;Reagent for High-Performance Polymer Research;Organics;Organic Fluorides;Pyridines ,Halogenated Heterocycles;rubber additive;rubber auxiliary;fine chemicals, specialty chemicals, intermediates, electronic chemical, organic synthesis, functional materials;bc0001 |
| Mol File: | 1478-61-1.mol |
| Bisphenol AF Chemical Properties |
| Melting point | 160-163 °C(lit.) |
| Boiling point | 400°C |
| density | 1.3837 (estimate) |
| vapor pressure | 0Pa at 20℃ |
| Fp | >100°C |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| pka | 8.74±0.10(Predicted) |
| form | powder |
| color | White to Pale Beige |
| Water Solubility | Insoluble in water. |
| BRN | 1891568 |
| Major Application | cleaning products cosmetics food and beverages personal care |
| InChI | 1S/C15H10F6O2/c16-14(17,18)13(15(19,20)21,9-1-5-11(22)6-2-9)10-3-7-12(23)8-4-10/h1-8,22-23H |
| InChIKey | ZFVMWEVVKGLCIJ-UHFFFAOYSA-N |
| SMILES | Oc1ccc(cc1)C(c2ccc(O)cc2)(C(F)(F)F)C(F)(F)F |
| LogP | 2.79 at 20℃ |
| CAS DataBase Reference | 1478-61-1(CAS DataBase Reference) |
| EPA Substance Registry System | Phenol, 4,4'-[2,2,2-trifluoro-1-(trifluoromethyl)ethylidene]bis- (1478-61-1) |
|
|
Contact Person: Maggie Ma
Tel: +0086 188 7414 9531