|
Product Details:
|
| Product Name: | Tetrabutylammonium Fluoride Trihydrate | CAS: | 87749-50-6 |
|---|---|---|---|
| EINECS: | 618-063-3 | Melting Point: | 62-63 °C(lit.) |
| Storage Temp.: | Store Below +30°C. | Form: | Crystalline Powder, Crystals And/or Chunks |
| Color: | White To Slightly Yellow | ||
| Highlight: | Tetrabutylammonium fluoride trihydrate lab reagent,Biochemical reagent for industrial labs,Tetrabutylammonium fluoride with warranty |
||
| Product Name: | Tetrabutylammonium fluoride trihydrate |
| Synonyms: | TETRA-N-BUTYLAMMONIUM FLUORIDE 3 H2O;Tetrabutylammonium f;Tetrakis(but-1-yl)ammonium fluoride trihydrate 97%;TetrabutylaMMoniuM fluoride trihydrate, 99% 10GR;TetrabutylaMMoniuM fluoride trihydrate, 99% 50GR;1-Butanaminium, N,N,N-tributyl-, fluoride, trihydrate;Tetrabutylammonium fluoride trihydrate 97%;Tetrabutylammoniumfluoridetrihydrate97% |
| CAS: | 87749-50-6 |
| MF: | C16H38FNO |
| MW: | 279.48 |
| EINECS: | 618-063-3 |
| Product Categories: | Pyridines ,Heterocyclic Acids;Pharmaceutical intermediates;bc0001 |
| Mol File: | 87749-50-6.mol |
| Tetrabutylammonium fluoride trihydrate Chemical Properties |
| Melting point | 62-63 °C(lit.) |
| Fp | -17℃ |
| storage temp. | Store below +30°C. |
| form | Crystalline Powder, Crystals and/or Chunks |
| Specific Gravity | 0.887 |
| color | White to slightly yellow |
| PH | pH (50g/l, 25℃) : 5.0~8.0 |
| Water Solubility | SOLUBLE |
| Sensitive | Hygroscopic |
| BRN | 3761900 |
| Exposure limits | ACGIH: TWA 2.5 mg/m3 NIOSH: IDLH 250 mg/m3 |
| InChI | InChI=1S/C16H36N.FH.H2O/c1-5-9-13-17(14-10-6-2,15-11-7-3)16-12-8-4;;/h5-16H2,1-4H3;1H;1H2/q+1;;/p-1 |
| InChIKey | UQCWXKSHRQJGPH-UHFFFAOYSA-M |
| SMILES | [N+](CCCC)(CCCC)(CCCC)CCCC.[F-].O |
| CAS DataBase Reference | 87749-50-6(CAS DataBase Reference) |
|
|
Contact Person: Maggie Ma
Tel: +0086 188 7414 9531