|
Product Details:
|
| Product Name: | 2,1,3-Benzothiadiazole | CAS: | 273-13-2 |
|---|---|---|---|
| EINECS: | 205-985-2 | Melting Point: | 42-44 °C (lit.) |
| Storage Temp.: | Sealed In Dry,Room Temperature | Form: | Low Melting Solid |
| Color: | Colorless To White To Pale Yellow | ||
| Highlight: | 2,1,3-Benzothiadiazole biochemical reagent,CAS 273-13-2 industrial chemical,Benzothiadiazole fine chemical reagent |
||
| 2,1,3-Benzothiadiazole Basic information |
| Product Name: | 2,1,3-Benzothiadiazole |
| Synonyms: | 2-Thia-1,3-diaza-2H-isoindene;3,4-Benzo-1,2,5-thiadiazole;Benzisothiadiazole;Benzo[1,2,5]thiadiazole;PIAZTHIOLE;2,1,3-BENZOTHIADIAZOLE;BENZO-2,1,3-THIADIAZOLE;3,4-Benzo-1,2,5-thiodiazol |
| CAS: | 273-13-2 |
| MF: | C6H4N2S |
| MW: | 136.17 |
| EINECS: | 205-985-2 |
| Product Categories: | Medical Intermediates |
| Mol File: | 273-13-2.mol |
| 2,1,3-Benzothiadiazole Chemical Properties |
| Melting point | 42-44 °C (lit.) |
| Boiling point | 206 °C (lit.) |
| density | 1.323 (estimate) |
| refractive index | 1.5300 (estimate) |
| Fp | 203 °F |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Solubility in methanol almost transparent. |
| pka | 0.37±0.33(Predicted) |
| form | Low Melting Solid |
| color | Colorless to white to pale yellow |
| BRN | 112408 |
| InChI | InChI=1S/C6H4N2S/c1-2-4-6-5(3-1)7-9-8-6/h1-4H |
| InChIKey | PDQRQJVPEFGVRK-UHFFFAOYSA-N |
| SMILES | N1=C2C=CC=CC2=NS1 |
| CAS DataBase Reference | 273-13-2(CAS DataBase Reference) |
| NIST Chemistry Reference | 2,1,3-Benzothiadiazole(273-13-2) |
| EPA Substance Registry System | 2,1,3-Benzothiadiazole (273-13-2) |
![]()
Contact Person: Maggie Ma
Tel: +0086 188 7414 9531