|
Product Details:
|
| Product Name: | Guar Gum | CAS: | 9000-30-0 |
|---|---|---|---|
| EINECS: | 232-536-8 | Melting Point: | >220°C (dec.) |
| Storage Temp.: | Hygroscopic, -20°C Freezer, Under Inert Atmosphere | Form: | Free Flowing Powder |
| Color: | Yellow-white | ||
| Highlight: | Guar gum biochemical reagent,Lab-grade guar gum,Industrial fine chemical guar gum |
||
CAS9000-30-0 Guar gum biochemical reagent for labs
| Product Name: | Guar gum |
| Synonyms: | Guar GuM Hydrolyzed;Guar Gum - HPMC;1212a;a-20d;burtonitev7e;burtonitev-7-e;cyamopsisgum;dealcatp1 |
| CAS: | 9000-30-0 |
| MF: | C10H14N5Na2O12P3 |
| MW: | 535.145283 |
| EINECS: | 232-536-8 |
| Product Categories: | thickener;Pharmaceutical intermediates;9000-30-0 |
| Mol File: | 9000-30-0.mol |
| Guar gum Chemical Properties |
| Melting point | >220°C (dec.) |
| alpha | D25 +53° (1N NaOH) |
| density | 0.8-1.0 g/cm3 |
| FEMA | 2537 | GUAR GUM (CYAMOPSIS TETRAGONOLOBUS (L.)) |
| refractive index | 1.34 |
| storage temp. | Hygroscopic, -20°C Freezer, Under inert atmosphere |
| solubility | It yields a mucilage of variable viscosity when dissolved in water, practically insoluble in ethanol (96 per cent). |
| form | Free Flowing Powder |
| color | Yellow-white |
| Odor | Odorless |
| PH | 5.0-7.0 (25°C1% in water) |
| Merck | 13,4588 / 13,4587 |
| Stability: | Stable. Combustible. A mixture of air and finely-divided powder is potentially explosive. Incompatible with strong oxidizing agents. |
| InChIKey | JEKDCIBJADJZSK-UHFFFAOYSA-L |
| SMILES | P(=O)(O[H])(OP(=O)([O-])OP(=O)([O-])O[H])OC([H])([H])C1([H])C([H])(C([H])([H])C([H])(N2C([H])=NC3=C(N([H])[H])N=C([H])N=C23)O1)O[H].[Na+].[Na+] |
| EPA Substance Registry System | Guar gum (9000-30-0) |
![]()
Contact Person: Maggie Ma
Tel: +0086 188 7414 9531