|
Product Details:
|
| Product Name: | Ferrozine Sodium | CAS: | 69898-45-9 |
|---|---|---|---|
| EINECS: | 274-196-3 | Melting Point: | ≥300 °C |
| Storage Temp.: | Store At RT. | Form: | Powder |
| Color: | Light Yellow To Yellow | ||
| Highlight: | Ferrozine sodium biochemical reagent,CAS 69898-45-9 Ferrozine reagent,industrial fine chemical Ferrozine |
||
CAS 69898-45-9 Ferrozine sodium
| Ferrozine sodium Basic information |
| Product Name: | Ferrozine sodium |
| Synonyms: | sodium 3-(pyridin-2-yl)-1,2,4-triazine-5,6-diyl]bis(benzene-4,4'-sulphonate);3-(2-PYRIDYL)5,6-DIPHE.-1,2,4-TRIAZI.-4' ,4''-DISULF.A. NA-ST;3-(2-PYRIDYL)-5,6-BIS(4-PHENYLSULFONIC*A CID)-1,2,4-;BENZENESULFONIC ACID, 4,4'-[3-(2-PYRIDNYL)-1,2,4-TRIAZINE-5,6-DIYL]BIS-, MONOSODIUM SALT;FERROZINE MONO-SODIUM SALT [ 3-(2-PYRIDYL)-5,6-BIS(4-SULFOPHENYL)-1,2,4-TRIAZINE, MONOSODIUM SALT ];Benzenesulfonic acid, 4,4'-[3-(2-pyridinyl)-1,2,4-triazine-5,6-diyl]bis-, sodium salt (1:1);5,6-diphenyl-3-(2-pyridyl)-1,2,4-triazine-4,4"-disulfonic acid monosodium salt hydrate;pdt-sulfonate monosodium salt hydrate |
| CAS: | 69898-45-9 |
| MF: | C20H15N4NaO6S2 |
| MW: | 494.47 |
| EINECS: | 274-196-3 |
| Product Categories: | |
| Mol File: | 69898-45-9.mol |
| Ferrozine sodium Chemical Properties |
| Melting point | ≥300 °C |
| storage temp. | Store at RT. |
| solubility | H2O: soluble50mg/mL |
| form | powder |
| color | Light yellow to yellow |
| Water Solubility | Soluble in water (partly). |
| BRN | 5222087 |
| InChIKey | LUPAZBXJUZRGRI-UHFFFAOYSA-N |
| SMILES | S(C1C=CC(C2=NC(C3N=CC=CC=3)=NN=C2C2C=CC(S(O)(=O)=O)=CC=2)=CC=1)(O)(=O)=O.[NaH] |
| CAS DataBase Reference | 69898-45-9(CAS DataBase Reference) |
| EPA Substance Registry System | Benzenesulfonic acid, 4,4'-[3-(2-pyridinyl)-1,2,4-triazine-5,6-diyl]bis-, monosodium salt (69898-45-9) |
![]()
Contact Person: Maggie Ma
Tel: +0086 188 7414 9531