|
Product Details:
|
| Product Name: | 4-Chloro-7-nitrobenzofurazan | CAS: | 10199-89-0 |
|---|---|---|---|
| EINECS: | 233-496-4 | Melting Point: | 97-99 °C(lit.) |
| Storage Temp.: | Inert Atmosphere,Room Temperature | Form: | Crystalline Powder |
| Color: | Yellow To Light Brown | ||
| Highlight: | 4-Chloro-7-nitrobenzofurazan biochemical reagent,CAS 10199-89-0 lab reagent,4-Chloro-7-nitrobenzofurazan industrial fine chemical |
||
CAS 10199-89-0 4-Chloro-7-nitrobenzofurazan biochemical reagent for labs
| 4-Chloro-7-nitrobenzofurazan Chemical Properties |
| Melting point | 97-99 °C(lit.) |
| Boiling point | 333.1±45.0 °C(Predicted) |
| density | 2.0589 (rough estimate) |
| refractive index | 1.5810 (estimate) |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | Soluble in methanol, dimethylsulfoxide, dimethylformamide and chloroform. |
| form | Crystalline Powder |
| pka | -5.65±0.50(Predicted) |
| color | Yellow to light brown |
| Water Solubility | soluble |
| BRN | 614212 |
| InChI | InChI=1S/C6H2ClN3O3/c7-3-1-2-4(10(11)12)6-5(3)8-13-9-6/h1-2H |
| InChIKey | IGHBXJSNZCFXNK-UHFFFAOYSA-N |
| SMILES | N1=C2C([N+]([O-])=O)=CC=C(Cl)C2=NO1 |
| CAS DataBase Reference | 10199-89-0(CAS DataBase Reference) |
| EPA Substance Registry System | 2,1,3-Benzoxadiazole, 4-chloro-7-nitro- (10199-89-0) |
![]()
Contact Person: Maggie Ma
Tel: +0086 188 7414 9531