|
Product Details:
|
| Product Name: | INULIN | CAS: | 9005-80-5 |
|---|---|---|---|
| EINECS: | 232-684-3 | Melting Point: | 176-181 °C |
| Storage Temp.: | Store At RT. | Form: | Solid |
| Color: | White To Off-White | ||
| Highlight: | INULIN biological stains,CAS9005-80-5 INULIN,industrial fine chemical stains |
||
CAS9004-57-3 Ethyl cellulose biological stains suppliers
| Product Name: | Ethyl cellulose |
| Synonyms: | ampacete/c;aquacoat;aquacoatecd30;aquacoatecd30fmc;cellulose,triethylether;celluloseethyl;nixone/c;spt50cps |
| CAS: | 9004-57-3 |
| MF: | C23H24N6O4 |
| MW: | 448.47446 |
| EINECS: | 618-384-9 |
| Product Categories: | Cellulose;Materials Science;Natural Polymers;Polymer Science;Polymers |
| Mol File: | 9004-57-3.mol |
| Ethyl cellulose Chemical Properties |
| Melting point | 240-255 °C |
| density | 1.14 g/mL at 25 °C (lit.) |
| refractive index | n20/D 1.47(lit.) |
| storage temp. | 2-8°C |
| solubility | esters, aromatic hydrocarbons, alcohols and ketones: soluble |
| form | powder |
| Specific Gravity | 1.14 |
| color | White to slightly yellow |
| Water Solubility | insoluble |
| Merck | 14,3781 |
| Dielectric constant | 2.8(Ambient) |
| InChI | InChI=1S/C23H24N6O4/c1-4-5-8-28(9-10-33-17(3)30)20-6-7-22(16(2)11-20)26-27-23-18(14-24)12-21(29(31)32)13-19(23)15-25/h6-7,11-13H,4-5,8-10H2,1-3H3/b27-26+ |
| InChIKey | ARSKJXYLLONUAJ-CYYJNZCTSA-N |
| SMILES | C(OCCN(CCCC)C1=CC=C(/N=N/C2=C(C#N)C=C([N+]([O-])=O)C=C2C#N)C(C)=C1)(=O)C |
| EPA Substance Registry System | Ethyl cellulose (9004-57-3) |
![]()
Contact Person: Maggie Ma
Tel: +0086 188 7414 9531