|
Product Details:
|
| Product Name: | 2,5-Dihydroxyterephthalic Acid | CAS: | 610-92-4 |
|---|---|---|---|
| EINECS: | 210-239-4 | Melting Point: | >300 °C (lit.) |
| Storage Temp.: | Sealed In Dry,Room Temperature | Form: | Solid |
| Color: | Dark Gray To Green | ||
| Highlight: | CAS610-92-4 biological stains,2,5-Dihydroxyterephthalic acid supplier,industrial fine chemical stains |
||
CAS610-92-4 2,5-Dihydroxyterephthalic acid biological stains suppliers
| Product Name: | 2,5-Dihydroxyterephthalic acid |
| Synonyms: | 2,5-Dihydroxytelephthalic acid;2,5-Dihydroxyterephthalic acid,2,5-Dihydroxy-1,4-benzenedicarboxylic acid;2,5-Dihydroxyterepht;2,5-dihydroxybenzene-1,4-dicarboxylic acid;2,5-DIHYDROXYTEREPHTHALIC ACID;2,5-Dihydroxy-1,4-benzenedicarboxylic acid;1,4-Benzenedicarboxylic acid, 2,5-dihydroxy-;2,5-Dihydroxyterephthalic acid 98% |
| CAS: | 610-92-4 |
| MF: | C8H6O6 |
| MW: | 198.13 |
| EINECS: | 210-239-4 |
| Product Categories: | Alternative Energy;Carboxylic Acid Monomers;Materials for Hydrogen Storage;Materials Science;Metal Organic Frameworks (MOFs);Monomers;Organic Linker Molecules;Physisorption;Polymer Science;610-92-4 |
| Mol File: | 610-92-4.mol |
| 2,5-Dihydroxyterephthalic acid Chemical Properties |
| Melting point | >300 °C (lit.) |
| Boiling point | 498.9±45.0 °C(Predicted) |
| density | 1.779±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Soluble in hot dimethylformamide. |
| pka | 2.17±0.10(Predicted) |
| form | Solid |
| color | Dark gray to green |
| InChI | InChI=1S/C8H6O6/c9-5-1-3(7(11)12)6(10)2-4(5)8(13)14/h1-2,9-10H,(H,11,12)(H,13,14) |
| InChIKey | OYFRNYNHAZOYNF-UHFFFAOYSA-N |
| SMILES | C1(C(O)=O)=CC(O)=C(C(O)=O)C=C1O |
![]()
Contact Person: Maggie Ma
Tel: +0086 188 7414 9531